destinyculbert1490 destinyculbert1490

12-01-2024
Geography

contestada

On Earth, it likely took about how many years for all the dissolved iron in the oceans to be used up?
A. 200 million
B. 20 million
C. 200,000
D. 2 billion

Respuesta :

Otras preguntas

Draw the best Lewis structure for CH3CH(CH3)CH2C(CH2CH3)2CHO, a neutral molecule. HELP PLEASE

Select the correct anwer. ¿Para qué irve un analgéico? A. Para tratar la inflamación B. Para tratar la infeccione C. Para tratar la fiebre D. Para tratar el

What causes led to the establishment of NAM ? How did it helped in duffusing military tensions in Asia and Africa?

If grapes are $1.99/pound and you buy 2.25 pounds of grapes, how much change will you receive if you hand the cashier a $5 bill

Which river did Mexico claim was the rightful border ?

All the light we cannot see The sentence fragments in paragraph 10 help convey Marie-Lauren’s

A man is climbing down from 250 feet high. He jumps 40 feet down and then descends at a rate of 30 feet per minute. How many minutes did it take him to reach th

The major chemical structures of hormones include a. polysaccharides, esters, and steroids. b. only molecules containing amine groups. c. steroids, amino acid

Please help 31 +5/9y =

Simplify. Write "undefined" for expressions that are undefined. 0 1 1) -4 1 6 5 - 4 1 0 -5 2 2) [6 -3 1-3]+[−4 −2_2_6]