raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

why do you think people settled what is now British Columbia before settling thse prairie provinces​
PLEASE HELP ME!!!! You are determining which tablet to purchase. Both tablets will perform the tasks you need them to, but the most expensive one will give you
Olga is married for the second time. Her first husband was blood type A and her child by that marriage was type O. Her new husband is type B and their child is
In Exercise, solve the equation for k. 25 = 16e-0.01k
if the individual are not in suitable condition to travel, the phase would include________.
Why does jackson want the native americans to relocate west of the mississippi river?
What is the purpose of DNA polymerase?
What is molar mass used to convert between?
the moon’s changing shape is caused by...
Differentiating a Logarithmic Function in Exercise, find the derivative of the function. See Examples 1, 2, 3, and 4. y = ln x/x^2