bankair3quiem658 bankair3quiem658

14-01-2022
Mathematics

contestada

350 divided by 10 to the 3rd power

Respuesta :

14-01-2022

Answer:

0.35

Step-by-step explanation:

350 divided by 10 to the 3rd power

350 : 10³ =

350 : 1000 =

0.35

Answer Link

Otras preguntas

As healthcare professionals, pharmacist co

who told the soldiers not to fire until the enemy was close enough to see the whites of there eyes

Draw the product formed by the reaction of t-butoxide with (1r,2s)-1-bromo-2-methyl-1-phenylbutane (shown below). (draw the correct stereoisomer of the product.

What evidence for a past evolutionary relationship can be seen in different groups of vertebrates?

Using the addition or subtraction formulas for sine or cosine... sin(a)sin(b)=(sin(a+b)+sin(a-b))/2

Given that a line has a slope of 5 and a point on the line is (2, 3), *Please show all work, step by step. 1. What is the equation of the line in point-slope fo

Two children on roller skates stand facing each other. The child on the right puts her arms out and pushes away from her partner what’s the action and reaction

please help Solve the system by substitution:

How did the Northwest Ordinance influence the government of Florida when it became an American territory?

1) Based on this i formation found in the periodic table, how many protons are in the nucleus are in the nucleus of one atom A) 30.18 B) 20.18 C) 20 D) 10