Seudónimo Seudónimo
  • 04-02-2021
  • English
contestada

help pls pls pls i need HEEELELLLLLPPP

help pls pls pls i need HEEELELLLLLPPP class=

Respuesta :

evaroaliciana
evaroaliciana evaroaliciana
  • 04-02-2021

Answer:

I personally think it is C

Explanation:

Answer Link

Otras preguntas

Which expression is equivalent to (x - 6) (2x2 - 3x + 4)? 2x2 - 2x - 2 2x2 - 2x + 4 2x3 - 3x2 + 4x - 6 2x3 - 15x2 + 22x - 24
PLZ HELP! at the apple orchard workers were asked to put 100 apples in barrels. the following five were filled incorrectly. if the supervisor wrote +5 above a b
sin(76)cos(31)-cos(76)sin(31)
How many grams of CO2 are in 6 mol of the compound (this is a science question)? and the units?
What is the outer edge of a frog blood cell called?
How long has daisy and gatsby known each other in louisville?
According to the map, slaves were MAINLY A) taken to Europe from the Americas in exchange for cotton. B) taken from Africa to Europe in exchange for manufactur
One of the differences between a career and a job is that a career: A. often lacks benefits packages. B. offers limited pay raises. C. provides better
The state lottery chooses one four-digit number at random every day. each digit can be 0, 1, 2, 3, 4, 5, 6, 7, 8, or 9. what is the probability that the same nu
Can someone explain the Pythagorean theorem to me, please?