cbmills7205 cbmills7205

11-11-2020
History

contestada

Why were iron tools more difficult for the Egyptians to obtain than copper ones?

Respuesta :

easports54 easports54

11-11-2020

This is because iron is more reactive than copper in the metal reactivity series.

Answer Link

Otras preguntas

A square room has a floor area of 16 square meters, the height of the room is 5 meters, what is the area of all 4 rooms?

If A: B = 5:7 and B: C = 3: 5, then A :B: C is:

what is the value of acceleration due to gravity at the pole, equator and the centre of the earth

A recursively defined is shown below

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

How many liters of carbon dioxide gas are there in 4 moles of CO2 at STP?

helppp pleasee it’s needed quick points

Find the slope of the line passing through the points (-1,5) and (-8,2)

NO LINKS!!!#47 & 48. Use the information to find the indicated value

A parallelogram is formed by the supports that attach a basketball backboard and rim to the wall. The angles change as the basketball apparatus is taken out and