Boone6568 Boone6568
  • 04-08-2020
  • Chemistry
contestada

Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Respuesta :

michaeld4th
michaeld4th michaeld4th
  • 04-08-2020

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer Link
mohammedshamil190 mohammedshamil190
  • 04-08-2020

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer Link

Otras preguntas

Is the following correspondence a function
Why are capillaries thin walled?
let f(x)=x^2 - 16. find f^-1(x).
When this car moves forward by 180 cm, each wheel does one full turn. What is the diameter of the wheels to the nearest centimetre?
If a 35 ft rope is cut into two sections with one section 6 times as long as the other section, how long is the shorter piece?
Holly decided to share 1/2 of her share of the pizza with Deb. How much did each of them actually?
let f(x)=9x-2 and g(x)=-x+3. find f(g(x)).
When this car moves forward by 180 cm, each wheel does one full turn. What is the diameter of the wheels to the nearest centimetre?
When this car moves forward by 180 cm, each wheel does one full turn. What is the diameter of the wheels to the nearest centimetre?
what is the GCF of 12x and 44xy