weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

Determine the equation, in vertex form, of a parabola that has been: (a) reflected in the x-axis and horizontally shifted right 4 units. (b) vertically compress

NEED HELP ASAP what is the mode of the data (A) 3 (B) no mode (C) 17 (D) 40 QUESTION #2 what is the mean of the data (A) 17 (B) 19.5 (C) 22 (D) 19 use the pic

A 2.0 kg block on a frictionless table is connected to two ideal massless springs with spring constants k1 and k2 whose opposite ends are fixed to walls. What i

What is the empirical formula for a compound if a sample contains 3.72 g of p and 21.28 g of cl? pcl5 pcl3 p2cl10 p2cl5

A regulator is required on a nitrogen cylinder to

The graph shows the velocity f(t) of a runner during a certain time interval: Graph of line segment going through ordered pairs 0, 2 and 6, 8. Graph of another

Can someone help me out and show work

6 4 2 0 A 2 4 C 6 8 What is the length of A"B"? 10 12 X Triangle A'B'C' is created by dilating triangle with a scale factor centered at the origin

What standard form polynomial expression represents the area of the triangle area = 1/2 bh

what are the possibilities and challenges of insurance?