tayah31
tayah31 tayah31
  • 13-11-2022
  • Mathematics
contestada

PLEASE HELP

Question 5 (3 points) M is the midpoint of segment LN. Find MN. L 7X-24 M 6x-2 N MN=​

Respuesta :

Otras preguntas

Add2√3+√5 and√3 -3√5​
Monomal by a Dinormal What is the product of x(x + 1)? O 2x+x 0x2+2x 022 +1 O x² + x will give brainliest
The left ventricle discharges blood into the __________, from which all systemic arteries of the body diverge to supply the body tissues.
The base of the pyramid is a rectangle that is not a square. Which statements correctly describe the symmetry of the pyramid? Check all that apply. The pyramid
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
Are the equations 18=3x-6+x and 18=4x-6 equivalent?​
HELP PLEASE!!!At the end of the nineteenth century, people from Southern and Eastern Europe were immigrating to the United States, whereas earlier immigrant gro
How does each new cell formed by cell division differ from the mature cell? OA. Each new cell has a smaller ratio of surface area to volume. B. Each new cell ha
which of these describes a responsibility of the federal reserve
Which of the following choices lists the values of the side lengths of a triangle with 45-45-90 degree angles and a leg = 5? 5, 5, 5 5, 1, 5 1, 5, 5 1, 1, 5